![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| processpatternsexamples.pdf | 2012-01-16 18:18 | 31K | |
| bpmn1.pdf | 2019-03-05 09:16 | 34K | |
| 2019 plan.pdf | 2019-01-03 10:23 | 35K | |
| Petri nets- more problems and other extensions.pdf | 2019-01-08 09:28 | 35K | |
| petri nets II.pdf | 2019-01-17 10:25 | 62K | |
| q2.png | 2019-01-10 10:25 | 67K | |
| bpmn2.pdf | 2019-03-05 09:16 | 68K | |
| bpmn3.pdf | 2019-03-05 09:16 | 70K | |
| q1.png | 2019-01-10 10:25 | 112K | |
| bpmn4.pdf | 2019-03-05 09:16 | 131K | |
| patternsOfSA.pdf | 2019-01-14 08:28 | 140K | |
| petri nets.pdf | 2019-01-08 09:27 | 186K | |
| nets.pdf | 2019-01-10 10:21 | 187K | |
| Pizza Process.pdf | 2019-03-05 09:16 | 228K | |
| Screenshot from 2019-02-12 09-27-10.png | 2019-02-12 09:25 | 239K | |
| ccs-and-ccs-based-architecture-structure-and-dynamics.pdf | 2019-02-06 19:05 | 352K | |
| zachman-poster-on-slide33.pdf | 2019-01-04 09:45 | 379K | |
| BPMN process examples.pdf | 2019-03-05 09:16 | 2.9M | |
| Software Architecture-History and Future-1.pdf | 2019-01-03 10:17 | 6.4M | |
| BPMN specification.pdf | 2019-03-05 09:16 | 6.8M | |